C15H20F3N3O3S — CID 4084659
ethyl 3,3,3-trifluoro-2-(propanoylamino)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate (PubChem CID 4084659) has the molecular formula C15H20F3N3O3S and a molecular weight of 379.40 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-(propanoylamino)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-(propanoylamino)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate |
|---|---|
| PubChem CID | 4084659 |
| Molecular Formula | C15H20F3N3O3S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-(propanoylamino)-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate |
| SMILES | CCOC(=O)C(NC(=O)CC)(Nc1nc2c(s1)CCCC2)C(F)(F)F |
| InChI | InChI=1S/C15H20F3N3O3S/c1-3-11(22)20-14(15(16,17)18,12(23)24-4-2)21-13-19-9-7-5-6-8-10(9)25-13/h3-8H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | OQUWJEFZWZDTLK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|