C25H25NO7 — CID 40849910
6-[(1S)-1-(3-ethoxy-4-hydroxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]hexanoic acid (PubChem CID 40849910) has the molecular formula C25H25NO7 and a molecular weight of 451.48 g/mol. Its IUPAC name is 6-[(1S)-1-(3-ethoxy-4-hydroxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]hexanoic acid.
| Compound Name | 6-[(1S)-1-(3-ethoxy-4-hydroxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 40849910 |
| Molecular Formula | C25H25NO7 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 6-[(1S)-1-(3-ethoxy-4-hydroxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]hexanoic acid |
| SMILES | CCOc1cc([C@H]2c3c(oc4ccccc4c3=O)C(=O)N2CCCCCC(=O)O)ccc1O |
| InChI | InChI=1S/C25H25NO7/c1-2-32-19-14-15(11-12-17(19)27)22-21-23(30)16-8-5-6-9-18(16)33-24(21)25(31)26(22)13-7-3-4-10-20(28)29/h5-6,8-9,11-12,14,22,27H,2-4,7,10,13H2,1H3,(H,28,29)/t22-/m0/s1 |
| InChIKey | PQNBTQDKSSRFGL-QFIPXVFZSA-N |
| XLogP | 4.09 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|