C17H17N3O8 — CID 40850499
2-[(1S,9S,13S)-1,9-dinitro-8-oxo-13-(2-oxopropyl)-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-yl]acetic acid (PubChem CID 40850499) has the molecular formula C17H17N3O8 and a molecular weight of 391.34 g/mol. Its IUPAC name is 2-[(1S,9S,13S)-1,9-dinitro-8-oxo-13-(2-oxopropyl)-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-yl]acetic acid.
| Compound Name | 2-[(1S,9S,13S)-1,9-dinitro-8-oxo-13-(2-oxopropyl)-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-yl]acetic acid |
|---|---|
| PubChem CID | 40850499 |
| Molecular Formula | C17H17N3O8 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-[(1S,9S,13S)-1,9-dinitro-8-oxo-13-(2-oxopropyl)-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-yl]acetic acid |
| SMILES | CC(=O)C[C@@H]1[C@]2([N+](=O)[O-])CN(CC(=O)O)C[C@@]1([N+](=O)[O-])c1ccccc1C2=O |
| InChI | InChI=1S/C17H17N3O8/c1-10(21)6-13-16(19(25)26)8-18(7-14(22)23)9-17(13,20(27)28)15(24)11-4-2-3-5-12(11)16/h2-5,13H,6-9H2,1H3,(H,22,23)/t13-,16+,17+/m0/s1 |
| InChIKey | HVIDBGGUKKEKKI-IAOVAPTHSA-N |
| XLogP | 0.37 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|