C24H42N2O5 — CID 4085097
bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-(ethoxymethylidene)propanedioate (PubChem CID 4085097) has the molecular formula C24H42N2O5 and a molecular weight of 438.61 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-(ethoxymethylidene)propanedioate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-(ethoxymethylidene)propanedioate |
|---|---|
| PubChem CID | 4085097 |
| Molecular Formula | C24H42N2O5 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-(ethoxymethylidene)propanedioate |
| SMILES | CCOC=C(C(=O)OC1CC(C)(C)NC(C)(C)C1)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C24H42N2O5/c1-10-29-15-18(19(27)30-16-11-21(2,3)25-22(4,5)12-16)20(28)31-17-13-23(6,7)26-24(8,9)14-17/h15-17,25-26H,10-14H2,1-9H3 |
| InChIKey | GAGWZOFKGWHNAP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|