C22H28N2O6S2 — CID 40851560
(2S)-2-[3-[(5E)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]hexanoic acid (PubChem CID 40851560) has the molecular formula C22H28N2O6S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is (2S)-2-[3-[(5E)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]hexanoic acid.
| Compound Name | (2S)-2-[3-[(5E)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 40851560 |
| Molecular Formula | C22H28N2O6S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | (2S)-2-[3-[(5E)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)CCN1C(=O)/C(=C\c2ccc(OCC)c(OC)c2)SC1=S)C(=O)O |
| InChI | InChI=1S/C22H28N2O6S2/c1-4-6-7-15(21(27)28)23-19(25)10-11-24-20(26)18(32-22(24)31)13-14-8-9-16(30-5-2)17(12-14)29-3/h8-9,12-13,15H,4-7,10-11H2,1-3H3,(H,23,25)(H,27,28)/b18-13+/t15-/m0/s1 |
| InChIKey | HKJJPWDMZWCKQP-VUODPORTSA-N |
| XLogP | 3.44 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|