C22H19N5O3S — CID 4085181
N-[(4-methylsulfonylphenyl)methyl]-4-(4-pyrimidin-4-ylpyrazol-1-yl)benzamide (PubChem CID 4085181) has the molecular formula C22H19N5O3S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[(4-methylsulfonylphenyl)methyl]-4-(4-pyrimidin-4-ylpyrazol-1-yl)benzamide.
| Compound Name | N-[(4-methylsulfonylphenyl)methyl]-4-(4-pyrimidin-4-ylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 4085181 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[(4-methylsulfonylphenyl)methyl]-4-(4-pyrimidin-4-ylpyrazol-1-yl)benzamide |
| SMILES | CS(=O)(=O)c1ccc(CNC(=O)c2ccc(-n3cc(-c4ccncn4)cn3)cc2)cc1 |
| InChI | InChI=1S/C22H19N5O3S/c1-31(29,30)20-8-2-16(3-9-20)12-24-22(28)17-4-6-19(7-5-17)27-14-18(13-26-27)21-10-11-23-15-25-21/h2-11,13-15H,12H2,1H3,(H,24,28) |
| InChIKey | GMKSYNFJCGBAPJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |