C27H27NO4 — CID 40853429
(20R)-20-(3-methoxyphenyl)-16,16-dimethyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,14(19)-pentaen-18-one (PubChem CID 40853429) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (20R)-20-(3-methoxyphenyl)-16,16-dimethyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,14(19)-pentaen-18-one.
| Compound Name | (20R)-20-(3-methoxyphenyl)-16,16-dimethyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,14(19)-pentaen-18-one |
|---|---|
| PubChem CID | 40853429 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (20R)-20-(3-methoxyphenyl)-16,16-dimethyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,14(19)-pentaen-18-one |
| SMILES | COc1cccc([C@H]2C=C3c4cc5c(cc4CCN3C3=C2C(=O)CC(C)(C)C3)OCO5)c1 |
| InChI | InChI=1S/C27H27NO4/c1-27(2)13-22-26(23(29)14-27)20(16-5-4-6-18(9-16)30-3)11-21-19-12-25-24(31-15-32-25)10-17(19)7-8-28(21)22/h4-6,9-12,20H,7-8,13-15H2,1-3H3/t20-/m1/s1 |
| InChIKey | KKBDZNJFNMHIIW-HXUWFJFHSA-N |
| XLogP | 5.06 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |