C22H20BrN3O5 — CID 4085383
methyl 4-(4-bromoanilino)-2-[(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)methyl]-3,4-dioxobutanoate (PubChem CID 4085383) has the molecular formula C22H20BrN3O5 and a molecular weight of 486.32 g/mol. Its IUPAC name is methyl 4-(4-bromoanilino)-2-[(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)methyl]-3,4-dioxobutanoate.
| Compound Name | methyl 4-(4-bromoanilino)-2-[(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)methyl]-3,4-dioxobutanoate |
|---|---|
| PubChem CID | 4085383 |
| Molecular Formula | C22H20BrN3O5 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | methyl 4-(4-bromoanilino)-2-[(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)methyl]-3,4-dioxobutanoate |
| SMILES | COC(=O)C(Cc1nc2cc(C)c(C)cc2[nH]c1=O)C(=O)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H20BrN3O5/c1-11-8-16-17(9-12(11)2)26-20(28)18(25-16)10-15(22(30)31-3)19(27)21(29)24-14-6-4-13(23)5-7-14/h4-9,15H,10H2,1-3H3,(H,24,29)(H,26,28) |
| InChIKey | IYPMXPRRRQWMRQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|