C11H12F3NO — CID 4085458
2,2,2-trifluoro-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 4085458) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 4085458 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2,2,2-trifluoro-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C11H12F3NO/c1-6-4-7(2)9(8(3)5-6)15-10(16)11(12,13)14/h4-5H,1-3H3,(H,15,16) |
| InChIKey | RAVMYLIAQVRULB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |