C23H21BrN2O5 — CID 40855027
1-[[(2R)-6-bromo-2-phenyl-4H-1,3-benzodioxin-8-yl]methyl]-3-cyclopentylimidazolidine-2,4,5-trione (PubChem CID 40855027) has the molecular formula C23H21BrN2O5 and a molecular weight of 485.33 g/mol. Its IUPAC name is 1-[[(2R)-6-bromo-2-phenyl-4H-1,3-benzodioxin-8-yl]methyl]-3-cyclopentylimidazolidine-2,4,5-trione.
| Compound Name | 1-[[(2R)-6-bromo-2-phenyl-4H-1,3-benzodioxin-8-yl]methyl]-3-cyclopentylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 40855027 |
| Molecular Formula | C23H21BrN2O5 |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 1-[[(2R)-6-bromo-2-phenyl-4H-1,3-benzodioxin-8-yl]methyl]-3-cyclopentylimidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(C2CCCC2)C(=O)N1Cc1cc(Br)cc2c1O[C@H](c1ccccc1)OC2 |
| InChI | InChI=1S/C23H21BrN2O5/c24-17-10-15(12-25-20(27)21(28)26(23(25)29)18-8-4-5-9-18)19-16(11-17)13-30-22(31-19)14-6-2-1-3-7-14/h1-3,6-7,10-11,18,22H,4-5,8-9,12-13H2/t22-/m1/s1 |
| InChIKey | HVFBNXKGKFAHEV-JOCHJYFZSA-N |
| XLogP | 4.29 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|