C20H25F2N3O5S — CID 40856240
N-[4-(difluoromethylsulfonyl)phenyl]-2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 40856240) has the molecular formula C20H25F2N3O5S and a molecular weight of 457.50 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfonyl)phenyl]-2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-[4-(difluoromethylsulfonyl)phenyl]-2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 40856240 |
| Molecular Formula | C20H25F2N3O5S |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | N-[4-(difluoromethylsulfonyl)phenyl]-2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | C[C@@H]1CC(C)(C)C[C@@]2(C1)NC(=O)N(CC(=O)Nc1ccc(S(=O)(=O)C(F)F)cc1)C2=O |
| InChI | InChI=1S/C20H25F2N3O5S/c1-12-8-19(2,3)11-20(9-12)16(27)25(18(28)24-20)10-15(26)23-13-4-6-14(7-5-13)31(29,30)17(21)22/h4-7,12,17H,8-11H2,1-3H3,(H,23,26)(H,24,28)/t12-,20-/m1/s1 |
| InChIKey | ZGAHAXMCAPUVPX-MPBGBICISA-N |
| XLogP | 2.76 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|