C24H20Cl3NO2 — CID 40856970
(E)-1-[(1S,2S)-2-(4-chlorophenyl)cyclopropyl]-N-[(2,4-dichlorophenyl)methoxy]-1-(4-methoxyphenyl)methanimine (PubChem CID 40856970) has the molecular formula C24H20Cl3NO2 and a molecular weight of 460.79 g/mol. Its IUPAC name is (E)-1-[(1S,2S)-2-(4-chlorophenyl)cyclopropyl]-N-[(2,4-dichlorophenyl)methoxy]-1-(4-methoxyphenyl)methanimine.
| Compound Name | (E)-1-[(1S,2S)-2-(4-chlorophenyl)cyclopropyl]-N-[(2,4-dichlorophenyl)methoxy]-1-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 40856970 |
| Molecular Formula | C24H20Cl3NO2 |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | (E)-1-[(1S,2S)-2-(4-chlorophenyl)cyclopropyl]-N-[(2,4-dichlorophenyl)methoxy]-1-(4-methoxyphenyl)methanimine |
| SMILES | COc1ccc(/C(=N/OCc2ccc(Cl)cc2Cl)[C@H]2C[C@@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H20Cl3NO2/c1-29-20-10-5-16(6-11-20)24(22-13-21(22)15-2-7-18(25)8-3-15)28-30-14-17-4-9-19(26)12-23(17)27/h2-12,21-22H,13-14H2,1H3/b28-24-/t21-,22+/m1/s1 |
| InChIKey | UOJQOEARVSIAAS-UPYHDDERSA-N |
| XLogP | 7.38 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|