C20H21F2N3O5S — CID 40861903
N-[2-(3,4-difluoroanilino)-2-oxoethyl]-4-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzamide (PubChem CID 40861903) has the molecular formula C20H21F2N3O5S and a molecular weight of 453.47 g/mol. Its IUPAC name is N-[2-(3,4-difluoroanilino)-2-oxoethyl]-4-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzamide.
| Compound Name | N-[2-(3,4-difluoroanilino)-2-oxoethyl]-4-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 40861903 |
| Molecular Formula | C20H21F2N3O5S |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[2-(3,4-difluoroanilino)-2-oxoethyl]-4-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(S(=O)(=O)NC[C@H]2CCCO2)cc1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H21F2N3O5S/c21-17-8-5-14(10-18(17)22)25-19(26)12-23-20(27)13-3-6-16(7-4-13)31(28,29)24-11-15-2-1-9-30-15/h3-8,10,15,24H,1-2,9,11-12H2,(H,23,27)(H,25,26)/t15-/m1/s1 |
| InChIKey | FHHRWHLUSRFERF-OAHLLOKOSA-N |
| XLogP | 1.79 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |