C6H4F9NO — CID 4086334
2,2,3,3,4,4,5,5,5-nonafluoro-N-methylpentanamide (PubChem CID 4086334) has the molecular formula C6H4F9NO and a molecular weight of 277.09 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-N-methylpentanamide.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-methylpentanamide |
|---|---|
| PubChem CID | 4086334 |
| Molecular Formula | C6H4F9NO |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-methylpentanamide |
| SMILES | CNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H4F9NO/c1-16-2(17)3(7,8)4(9,10)5(11,12)6(13,14)15/h1H3,(H,16,17) |
| InChIKey | HDDQYUSNJSEGHK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|