C18H11F3N6O4 — CID 40865166
6-[(3-nitrophenyl)methyl]-3-[4-(trifluoromethoxy)phenyl]triazolo[4,5-d]pyrimidin-7-one (PubChem CID 40865166) has the molecular formula C18H11F3N6O4 and a molecular weight of 432.32 g/mol. Its IUPAC name is 6-[(3-nitrophenyl)methyl]-3-[4-(trifluoromethoxy)phenyl]triazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 6-[(3-nitrophenyl)methyl]-3-[4-(trifluoromethoxy)phenyl]triazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 40865166 |
| Molecular Formula | C18H11F3N6O4 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 6-[(3-nitrophenyl)methyl]-3-[4-(trifluoromethoxy)phenyl]triazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=c1c2nnn(-c3ccc(OC(F)(F)F)cc3)c2ncn1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H11F3N6O4/c19-18(20,21)31-14-6-4-12(5-7-14)26-16-15(23-24-26)17(28)25(10-22-16)9-11-2-1-3-13(8-11)27(29)30/h1-8,10H,9H2 |
| InChIKey | BPCGANHGGKFEAB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 117.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|