C26H22N4O3S — CID 40868798
N-[2-(4-nitrophenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-3,3-diphenylpropanamide (PubChem CID 40868798) has the molecular formula C26H22N4O3S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-[2-(4-nitrophenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-3,3-diphenylpropanamide.
| Compound Name | N-[2-(4-nitrophenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 40868798 |
| Molecular Formula | C26H22N4O3S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | N-[2-(4-nitrophenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Nc1c2c(nn1-c1ccc([N+](=O)[O-])cc1)CSC2 |
| InChI | InChI=1S/C26H22N4O3S/c31-25(15-22(18-7-3-1-4-8-18)19-9-5-2-6-10-19)27-26-23-16-34-17-24(23)28-29(26)20-11-13-21(14-12-20)30(32)33/h1-14,22H,15-17H2,(H,27,31) |
| InChIKey | FQJWRGWRQZQZIW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|