About (2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone
(2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone (PubChem CID 4087133) has the molecular formula C15H14N2O2S
and a molecular weight of 286.36 g/mol. Its IUPAC name is (2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone.
Molecular Properties
| Compound Name | (2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone |
| PubChem CID | 4087133 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCN=C1SCc1ccccc1 |
| InChI | InChI=1S/C15H14N2O2S/c18-14(13-7-4-10-19-13)17-9-8-16-15(17)20-11-12-5-2-1-3-6-12/h1-7,10H,8-9,11H2 |
| InChIKey | FPIHXNKTNAKUNX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone?
The IUPAC name of (2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone (CID 4087133) is (2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone.
What is the SMILES notation for (2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone?
The canonical SMILES for (2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone is O=C(c1ccco1)N1CCN=C1SCc1ccccc1.
What is the InChIKey of (2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone?
The InChIKey is FPIHXNKTNAKUNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2S/c18-14(13-7-4-10-19-13)17-9-8-16-15(17)20-11-12-5-2-1-3-6-12/h1-7,10H,8-9,11H2.
What are the key properties of (2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone?
(2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone has a molecular weight of 286.36 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzylsulfanyl-4,5-dihydroimidazol-1-yl)-(furan-2-yl)methanone is sourced from PubChem (CID 4087133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).