C21H16N2O4 — CID 40871855
(1S)-1',2,6-trimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 40871855) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is (1S)-1',2,6-trimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | (1S)-1',2,6-trimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 40871855 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (1S)-1',2,6-trimethylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | Cc1ccc2c(=O)c3c(oc2c1)C(=O)N(C)[C@]31C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C21H16N2O4/c1-11-8-9-12-15(10-11)27-18-16(17(12)24)21(23(3)19(18)25)13-6-4-5-7-14(13)22(2)20(21)26/h4-10H,1-3H3/t21-/m0/s1 |
| InChIKey | HYGYPZQOQBPXJX-NRFANRHFSA-N |
| XLogP | 2.41 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |