C22H21ClN4OS2 — CID 40872066
N-[(3aS,7aR)-3-cyano-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-2-yl]-5-chloro-2-[(3-methylphenyl)methylsulfanyl]pyrimidine-4-carboxamide (PubChem CID 40872066) has the molecular formula C22H21ClN4OS2 and a molecular weight of 457.02 g/mol. Its IUPAC name is N-[(3aS,7aR)-3-cyano-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-2-yl]-5-chloro-2-[(3-methylphenyl)methylsulfanyl]pyrimidine-4-carboxamide.
| Compound Name | N-[(3aS,7aR)-3-cyano-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-2-yl]-5-chloro-2-[(3-methylphenyl)methylsulfanyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 40872066 |
| Molecular Formula | C22H21ClN4OS2 |
| Molecular Weight | 457.02 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | N-[(3aS,7aR)-3-cyano-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-2-yl]-5-chloro-2-[(3-methylphenyl)methylsulfanyl]pyrimidine-4-carboxamide |
| SMILES | Cc1cccc(CSc2ncc(Cl)c(C(=O)NC3=C(C#N)[C@@H]4CCCC[C@H]4S3)n2)c1 |
| InChI | InChI=1S/C22H21ClN4OS2/c1-13-5-4-6-14(9-13)12-29-22-25-11-17(23)19(26-22)20(28)27-21-16(10-24)15-7-2-3-8-18(15)30-21/h4-6,9,11,15,18H,2-3,7-8,12H2,1H3,(H,27,28)/t15-,18+/m0/s1 |
| InChIKey | PFTRUSFYMKRDOL-MAUKXSAKSA-N |
| XLogP | 5.50 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.02 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |