C18H28N6O3 — CID 40873251
2-N,2-N-dimethyl-6-[(1R)-1-[methyl-[(2,3,4-trimethoxyphenyl)methyl]amino]ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 40873251) has the molecular formula C18H28N6O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[(1R)-1-[methyl-[(2,3,4-trimethoxyphenyl)methyl]amino]ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[(1R)-1-[methyl-[(2,3,4-trimethoxyphenyl)methyl]amino]ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 40873251 |
| Molecular Formula | C18H28N6O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[(1R)-1-[methyl-[(2,3,4-trimethoxyphenyl)methyl]amino]ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(CN(C)[C@H](C)c2nc(N)nc(N(C)C)n2)c(OC)c1OC |
| InChI | InChI=1S/C18H28N6O3/c1-11(16-20-17(19)22-18(21-16)23(2)3)24(4)10-12-8-9-13(25-5)15(27-7)14(12)26-6/h8-9,11H,10H2,1-7H3,(H2,19,20,21,22)/t11-/m1/s1 |
| InChIKey | OICOFSOGDDQYCW-LLVKDONJSA-N |
| XLogP | 1.74 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |