C26H29ClN2O2S — CID 40873370
(2R,7R)-2-[5-(3-chloro-4-methylphenyl)furan-2-yl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 40873370) has the molecular formula C26H29ClN2O2S and a molecular weight of 469.05 g/mol. Its IUPAC name is (2R,7R)-2-[5-(3-chloro-4-methylphenyl)furan-2-yl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2R,7R)-2-[5-(3-chloro-4-methylphenyl)furan-2-yl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 40873370 |
| Molecular Formula | C26H29ClN2O2S |
| Molecular Weight | 469.05 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (2R,7R)-2-[5-(3-chloro-4-methylphenyl)furan-2-yl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCC(C)(C)[C@@H]1CCc2c(sc3c2C(=O)N[C@@H](c2ccc(-c4ccc(C)c(Cl)c4)o2)N3)C1 |
| InChI | InChI=1S/C26H29ClN2O2S/c1-5-26(3,4)16-8-9-17-21(13-16)32-25-22(17)24(30)28-23(29-25)20-11-10-19(31-20)15-7-6-14(2)18(27)12-15/h6-7,10-12,16,23,29H,5,8-9,13H2,1-4H3,(H,28,30)/t16-,23-/m1/s1 |
| InChIKey | JKWRIUCCBSMEEU-WAIKUNEKSA-N |
| XLogP | 7.37 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.05 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |