C25H27ClN2O2S — CID 40873394
(2R,7R)-2-[5-(2-chlorophenyl)furan-2-yl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 40873394) has the molecular formula C25H27ClN2O2S and a molecular weight of 455.02 g/mol. Its IUPAC name is (2R,7R)-2-[5-(2-chlorophenyl)furan-2-yl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2R,7R)-2-[5-(2-chlorophenyl)furan-2-yl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 40873394 |
| Molecular Formula | C25H27ClN2O2S |
| Molecular Weight | 455.02 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | (2R,7R)-2-[5-(2-chlorophenyl)furan-2-yl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCC(C)(C)[C@@H]1CCc2c(sc3c2C(=O)N[C@@H](c2ccc(-c4ccccc4Cl)o2)N3)C1 |
| InChI | InChI=1S/C25H27ClN2O2S/c1-4-25(2,3)14-9-10-16-20(13-14)31-24-21(16)23(29)27-22(28-24)19-12-11-18(30-19)15-7-5-6-8-17(15)26/h5-8,11-12,14,22,28H,4,9-10,13H2,1-3H3,(H,27,29)/t14-,22-/m1/s1 |
| InChIKey | IAJALGRFFMPPEY-JLCFBVMHSA-N |
| XLogP | 7.06 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.02 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |