C23H19ClFN3O2 — CID 4087399
N-[3-[N-[[2-(4-chlorophenyl)acetyl]amino]-C-methylcarbonimidoyl]phenyl]-3-fluorobenzamide (PubChem CID 4087399) has the molecular formula C23H19ClFN3O2 and a molecular weight of 423.88 g/mol. Its IUPAC name is N-[3-[N-[[2-(4-chlorophenyl)acetyl]amino]-C-methylcarbonimidoyl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[3-[N-[[2-(4-chlorophenyl)acetyl]amino]-C-methylcarbonimidoyl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 4087399 |
| Molecular Formula | C23H19ClFN3O2 |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-[3-[N-[[2-(4-chlorophenyl)acetyl]amino]-C-methylcarbonimidoyl]phenyl]-3-fluorobenzamide |
| SMILES | CC(=NNC(=O)Cc1ccc(Cl)cc1)c1cccc(NC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C23H19ClFN3O2/c1-15(27-28-22(29)12-16-8-10-19(24)11-9-16)17-4-3-7-21(14-17)26-23(30)18-5-2-6-20(25)13-18/h2-11,13-14H,12H2,1H3,(H,26,30)(H,28,29) |
| InChIKey | CIJMEXLQBXOJBR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|