C18H16Cl2N4O2S — CID 40874425
4-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 40874425) has the molecular formula C18H16Cl2N4O2S and a molecular weight of 423.33 g/mol. Its IUPAC name is 4-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 40874425 |
| Molecular Formula | C18H16Cl2N4O2S |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 4-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(/C=N\n2cn[nH]c2=S)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2N4O2S/c1-2-25-17-8-12(9-22-24-11-21-23-18(24)27)4-6-16(17)26-10-13-3-5-14(19)15(20)7-13/h3-9,11H,2,10H2,1H3,(H,23,27)/b22-9- |
| InChIKey | WPKBVUQSDKVFFX-AFPJDJCSSA-N |
| XLogP | 5.11 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|