C23H31N5O2S — CID 40878968
2-[[5-(4-tert-butylphenyl)-4-cyclopentyl-1,2,4-triazol-3-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide (PubChem CID 40878968) has the molecular formula C23H31N5O2S and a molecular weight of 441.60 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-cyclopentyl-1,2,4-triazol-3-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-cyclopentyl-1,2,4-triazol-3-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 40878968 |
| Molecular Formula | C23H31N5O2S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-cyclopentyl-1,2,4-triazol-3-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
| SMILES | C=CCNC(=O)NC(=O)CSc1nnc(-c2ccc(C(C)(C)C)cc2)n1C1CCCC1 |
| InChI | InChI=1S/C23H31N5O2S/c1-5-14-24-21(30)25-19(29)15-31-22-27-26-20(28(22)18-8-6-7-9-18)16-10-12-17(13-11-16)23(2,3)4/h5,10-13,18H,1,6-9,14-15H2,2-4H3,(H2,24,25,29,30) |
| InChIKey | DJWGKHXIPVPKDK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|