C16H18N4O6S — CID 40880788
[(2R)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate (PubChem CID 40880788) has the molecular formula C16H18N4O6S and a molecular weight of 394.41 g/mol. Its IUPAC name is [(2R)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate.
| Compound Name | [(2R)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 40880788 |
| Molecular Formula | C16H18N4O6S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | [(2R)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
| SMILES | CC[C@@H](OC(=O)C1=CN2CCS(=O)(=O)N=C2C=C1)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C16H18N4O6S/c1-3-12(15(21)17-13-8-10(2)26-18-13)25-16(22)11-4-5-14-19-27(23,24)7-6-20(14)9-11/h4-5,8-9,12H,3,6-7H2,1-2H3,(H,17,18,21)/t12-/m1/s1 |
| InChIKey | XEBWUXWNKTXEQC-GFCCVEGCSA-N |
| XLogP | 0.74 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |