C21H18Cl2N2O4 — CID 40884873
(7R,11R)-7,11-bis(2-chlorophenyl)-9-hydroxy-2,4-diazaspiro[5.5]undecane-1,3,5-trione (PubChem CID 40884873) has the molecular formula C21H18Cl2N2O4 and a molecular weight of 433.29 g/mol. Its IUPAC name is (7R,11R)-7,11-bis(2-chlorophenyl)-9-hydroxy-2,4-diazaspiro[5.5]undecane-1,3,5-trione.
| Compound Name | (7R,11R)-7,11-bis(2-chlorophenyl)-9-hydroxy-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
|---|---|
| PubChem CID | 40884873 |
| Molecular Formula | C21H18Cl2N2O4 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | (7R,11R)-7,11-bis(2-chlorophenyl)-9-hydroxy-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
| SMILES | O=C1NC(=O)C2(C(=O)N1)[C@H](c1ccccc1Cl)CC(O)C[C@H]2c1ccccc1Cl |
| InChI | InChI=1S/C21H18Cl2N2O4/c22-16-7-3-1-5-12(16)14-9-11(26)10-15(13-6-2-4-8-17(13)23)21(14)18(27)24-20(29)25-19(21)28/h1-8,11,14-15,26H,9-10H2,(H2,24,25,27,28,29)/t14-,15-/m0/s1 |
| InChIKey | IXMSRPLKPNKWJO-GJZGRUSLSA-N |
| XLogP | 3.37 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|