C17H15ClN2OS — CID 40885113
3-chloro-N-(3,5,7-trimethyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 40885113) has the molecular formula C17H15ClN2OS and a molecular weight of 330.84 g/mol. Its IUPAC name is 3-chloro-N-(3,5,7-trimethyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 3-chloro-N-(3,5,7-trimethyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 40885113 |
| Molecular Formula | C17H15ClN2OS |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3-chloro-N-(3,5,7-trimethyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | Cc1cc(C)c2s/c(=N\C(=O)c3cccc(Cl)c3)n(C)c2c1 |
| InChI | InChI=1S/C17H15ClN2OS/c1-10-7-11(2)15-14(8-10)20(3)17(22-15)19-16(21)12-5-4-6-13(18)9-12/h4-9H,1-3H3/b19-17- |
| InChIKey | NZKBZHNOAQCJKN-ZPHPHTNESA-N |
| XLogP | 4.25 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |