C17H14Cl2N2OS — CID 40885241
2,5-dichloro-N-(3,4,7-trimethyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 40885241) has the molecular formula C17H14Cl2N2OS and a molecular weight of 365.29 g/mol. Its IUPAC name is 2,5-dichloro-N-(3,4,7-trimethyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 2,5-dichloro-N-(3,4,7-trimethyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 40885241 |
| Molecular Formula | C17H14Cl2N2OS |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 2,5-dichloro-N-(3,4,7-trimethyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | Cc1ccc(C)c2c1s/c(=N\C(=O)c1cc(Cl)ccc1Cl)n2C |
| InChI | InChI=1S/C17H14Cl2N2OS/c1-9-4-5-10(2)15-14(9)21(3)17(23-15)20-16(22)12-8-11(18)6-7-13(12)19/h4-8H,1-3H3/b20-17- |
| InChIKey | QDEDALJNQZBPMS-JZJYNLBNSA-N |
| XLogP | 4.90 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |