C16H10Cl2N2OS2 — CID 40885863
5-chloro-N-(5-chloro-4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)thiophene-2-carboxamide (PubChem CID 40885863) has the molecular formula C16H10Cl2N2OS2 and a molecular weight of 381.31 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(5-chloro-4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 40885863 |
| Molecular Formula | C16H10Cl2N2OS2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | 5-chloro-N-(5-chloro-4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)thiophene-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(Cl)s2)sc2ccc(Cl)c(C)c21 |
| InChI | InChI=1S/C16H10Cl2N2OS2/c1-3-8-20-14-9(2)10(17)4-5-11(14)23-16(20)19-15(21)12-6-7-13(18)22-12/h1,4-7H,8H2,2H3/b19-16- |
| InChIKey | RIWJAPPPNGGBOI-MNDPQUGUSA-N |
| XLogP | 4.75 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|