C24H29N3O5 — CID 40887158
N-[3,3-dimethyl-5-(3-methylbutyl)-4-oxo-2H-1,5-benzoxazepin-8-yl]-3-methyl-4-nitrobenzamide (PubChem CID 40887158) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is N-[3,3-dimethyl-5-(3-methylbutyl)-4-oxo-2H-1,5-benzoxazepin-8-yl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[3,3-dimethyl-5-(3-methylbutyl)-4-oxo-2H-1,5-benzoxazepin-8-yl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 40887158 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[3,3-dimethyl-5-(3-methylbutyl)-4-oxo-2H-1,5-benzoxazepin-8-yl]-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc3c(c2)OCC(C)(C)C(=O)N3CCC(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H29N3O5/c1-15(2)10-11-26-20-9-7-18(13-21(20)32-14-24(4,5)23(26)29)25-22(28)17-6-8-19(27(30)31)16(3)12-17/h6-9,12-13,15H,10-11,14H2,1-5H3,(H,25,28) |
| InChIKey | INJAEYXPAZDVSJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|