C12H9F9N2O3S — CID 4089036
2,2,3,3,4,4,5,5,5-nonafluoro-N-[(4-sulfamoylphenyl)methyl]pentanamide (PubChem CID 4089036) has the molecular formula C12H9F9N2O3S and a molecular weight of 432.26 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-N-[(4-sulfamoylphenyl)methyl]pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-[(4-sulfamoylphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 4089036 |
| Molecular Formula | C12H9F9N2O3S |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-[(4-sulfamoylphenyl)methyl]pentanamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9F9N2O3S/c13-9(14,10(15,16)11(17,18)12(19,20)21)8(24)23-5-6-1-3-7(4-2-6)27(22,25)26/h1-4H,5H2,(H,23,24)(H2,22,25,26) |
| InChIKey | GAVHLPDPYHDYNF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|