C18H23N5O3 — CID 40890372
N-[(2R)-2-(dimethylamino)-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-N'-(1,2-oxazol-3-yl)oxamide (PubChem CID 40890372) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-N'-(1,2-oxazol-3-yl)oxamide.
| Compound Name | N-[(2R)-2-(dimethylamino)-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-N'-(1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 40890372 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-N'-(1,2-oxazol-3-yl)oxamide |
| SMILES | CN1CCc2cc([C@H](CNC(=O)C(=O)Nc3ccon3)N(C)C)ccc21 |
| InChI | InChI=1S/C18H23N5O3/c1-22(2)15(12-4-5-14-13(10-12)6-8-23(14)3)11-19-17(24)18(25)20-16-7-9-26-21-16/h4-5,7,9-10,15H,6,8,11H2,1-3H3,(H,19,24)(H,20,21,25)/t15-/m0/s1 |
| InChIKey | YQSUHKCVWBHZQF-HNNXBMFYSA-N |
| XLogP | 1.02 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|