About N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide
N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide (PubChem CID 40891783) has the molecular formula C16H15FN2O3S2
and a molecular weight of 366.44 g/mol. Its IUPAC name is N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide.
Molecular Properties
| Compound Name | N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide |
| PubChem CID | 40891783 |
| Molecular Formula | C16H15FN2O3S2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide |
| SMILES | CCn1c(=NS(=O)(=O)c2ccc(OC)cc2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C16H15FN2O3S2/c1-3-19-14-9-4-11(17)10-15(14)23-16(19)18-24(20,21)13-7-5-12(22-2)6-8-13/h4-10H,3H2,1-2H3 |
| InChIKey | XVUGOXOVRJXUTB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide?
The IUPAC name of N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide (CID 40891783) is N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide.
What is the SMILES notation for N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide?
The canonical SMILES for N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide is CCn1c(=NS(=O)(=O)c2ccc(OC)cc2)sc2cc(F)ccc21.
What is the InChIKey of N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide?
The InChIKey is XVUGOXOVRJXUTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN2O3S2/c1-3-19-14-9-4-11(17)10-15(14)23-16(19)18-24(20,21)13-7-5-12(22-2)6-8-13/h4-10H,3H2,1-2H3.
What are the key properties of N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide?
N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide has a molecular weight of 366.44 g/mol, XLogP of 3.16, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethyl-6-fluoro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide is sourced from PubChem (CID 40891783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).