C17H18Cl2N2O3S — CID 4089180
1-(2,6-dichlorophenyl)sulfonyl-4-(2-methoxyphenyl)piperazine (PubChem CID 4089180) has the molecular formula C17H18Cl2N2O3S and a molecular weight of 401.32 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)sulfonyl-4-(2-methoxyphenyl)piperazine.
| Compound Name | 1-(2,6-dichlorophenyl)sulfonyl-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 4089180 |
| Molecular Formula | C17H18Cl2N2O3S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 1-(2,6-dichlorophenyl)sulfonyl-4-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1N1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C17H18Cl2N2O3S/c1-24-16-8-3-2-7-15(16)20-9-11-21(12-10-20)25(22,23)17-13(18)5-4-6-14(17)19/h2-8H,9-12H2,1H3 |
| InChIKey | YELVVQJLRSKCCX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |