About 4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide
4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide (PubChem CID 4089495) has the molecular formula C15H21N3O3S
and a molecular weight of 323.42 g/mol. Its IUPAC name is 4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide |
| PubChem CID | 4089495 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2c(C)nn(CC)c2C)cc1 |
| InChI | InChI=1S/C15H21N3O3S/c1-5-18-12(4)15(11(3)16-18)17-22(19,20)14-9-7-13(8-10-14)21-6-2/h7-10,17H,5-6H2,1-4H3 |
| InChIKey | WDSFPBQBWNLYMX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide?
The IUPAC name of 4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide (CID 4089495) is 4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide.
What is the SMILES notation for 4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide?
The canonical SMILES for 4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide is CCOc1ccc(S(=O)(=O)Nc2c(C)nn(CC)c2C)cc1.
What is the InChIKey of 4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide?
The InChIKey is WDSFPBQBWNLYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O3S/c1-5-18-12(4)15(11(3)16-18)17-22(19,20)14-9-7-13(8-10-14)21-6-2/h7-10,17H,5-6H2,1-4H3.
What are the key properties of 4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide?
4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide has a molecular weight of 323.42 g/mol, XLogP of 2.72, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)benzenesulfonamide is sourced from PubChem (CID 4089495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).