C16H21N7S2 — CID 40895118
2-N,2-N-dimethyl-6-[(1S)-1-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 40895118) has the molecular formula C16H21N7S2 and a molecular weight of 375.53 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[(1S)-1-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[(1S)-1-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 40895118 |
| Molecular Formula | C16H21N7S2 |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[(1S)-1-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1nc(S[C@@H](C)c2nc(N)nc(N(C)C)n2)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C16H21N7S2/c1-7-8(2)24-13-11(7)14(19-10(4)18-13)25-9(3)12-20-15(17)22-16(21-12)23(5)6/h9H,1-6H3,(H2,17,20,21,22)/t9-/m0/s1 |
| InChIKey | LGTZXLGQMYYHCR-VIFPVBQESA-N |
| XLogP | 3.30 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |