C26H32N2O3 — CID 40895435
N-(2,6-dimethylphenyl)-2-[(6R)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl]acetamide (PubChem CID 40895435) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[(6R)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[(6R)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl]acetamide |
|---|---|
| PubChem CID | 40895435 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[(6R)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CC2(CCCC2)c2cc3c(cc2[C@H]1C)OCCO3 |
| InChI | InChI=1S/C26H32N2O3/c1-17-7-6-8-18(2)25(17)27-24(29)15-28-16-26(9-4-5-10-26)21-14-23-22(30-11-12-31-23)13-20(21)19(28)3/h6-8,13-14,19H,4-5,9-12,15-16H2,1-3H3,(H,27,29)/t19-/m1/s1 |
| InChIKey | RAPRFNYZSAFSBJ-LJQANCHMSA-N |
| XLogP | 4.90 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |