About (2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol
(2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol (PubChem CID 40895474) has the molecular formula C9H12F3NO2
and a molecular weight of 223.19 g/mol. Its IUPAC name is (2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol.
Molecular Properties
| Compound Name | (2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol |
| PubChem CID | 40895474 |
| Molecular Formula | C9H12F3NO2 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol |
| SMILES | Cc1ccc([C@@](O)(CCN)C(F)(F)F)o1 |
| InChI | InChI=1S/C9H12F3NO2/c1-6-2-3-7(15-6)8(14,4-5-13)9(10,11)12/h2-3,14H,4-5,13H2,1H3/t8-/m0/s1 |
| InChIKey | LGRROCWYDUUILY-QMMMGPOBSA-N |
| XLogP | 1.69 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol?
The IUPAC name of (2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol (CID 40895474) is (2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol.
What is the SMILES notation for (2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol?
The canonical SMILES for (2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol is Cc1ccc([C@@](O)(CCN)C(F)(F)F)o1.
What is the InChIKey of (2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol?
The InChIKey is LGRROCWYDUUILY-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H12F3NO2/c1-6-2-3-7(15-6)8(14,4-5-13)9(10,11)12/h2-3,14H,4-5,13H2,1H3/t8-/m0/s1.
What are the key properties of (2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol?
(2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol has a molecular weight of 223.19 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-amino-1,1,1-trifluoro-2-(5-methylfuran-2-yl)butan-2-ol is sourced from PubChem (CID 40895474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).