C20H18N6O — CID 4089891
6-N-(furan-2-ylmethyl)-2-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 4089891) has the molecular formula C20H18N6O and a molecular weight of 358.41 g/mol. Its IUPAC name is 6-N-(furan-2-ylmethyl)-2-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(furan-2-ylmethyl)-2-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 4089891 |
| Molecular Formula | C20H18N6O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 6-N-(furan-2-ylmethyl)-2-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1ccc(Nc2nc(NCc3ccco3)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H18N6O/c1-3-8-15(9-4-1)22-19-24-18(21-14-17-12-7-13-27-17)25-20(26-19)23-16-10-5-2-6-11-16/h1-13H,14H2,(H3,21,22,23,24,25,26) |
| InChIKey | VBMNXBHAOBMCMX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |