About N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide
N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide (PubChem CID 40900470) has the molecular formula C10H18ClNO3S
and a molecular weight of 267.78 g/mol. Its IUPAC name is N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide.
Molecular Properties
| Compound Name | N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide |
| PubChem CID | 40900470 |
| Molecular Formula | C10H18ClNO3S |
| Molecular Weight | 267.78 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide |
| SMILES | CCCCCC(=O)N[C@@H]1CS(=O)(=O)C[C@@H]1Cl |
| InChI | InChI=1S/C10H18ClNO3S/c1-2-3-4-5-10(13)12-9-7-16(14,15)6-8(9)11/h8-9H,2-7H2,1H3,(H,12,13)/t8-,9+/m0/s1 |
| InChIKey | ZAWCOMDWKMALGL-DTWKUNHWSA-N |
| XLogP | 1.09 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.78 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide?
The IUPAC name of N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide (CID 40900470) is N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide.
What is the SMILES notation for N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide?
The canonical SMILES for N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide is CCCCCC(=O)N[C@@H]1CS(=O)(=O)C[C@@H]1Cl.
What is the InChIKey of N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide?
The InChIKey is ZAWCOMDWKMALGL-DTWKUNHWSA-N. The full InChI is InChI=1S/C10H18ClNO3S/c1-2-3-4-5-10(13)12-9-7-16(14,15)6-8(9)11/h8-9H,2-7H2,1H3,(H,12,13)/t8-,9+/m0/s1.
What are the key properties of N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide?
N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide has a molecular weight of 267.78 g/mol, XLogP of 1.09, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]hexanamide is sourced from PubChem (CID 40900470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).