C18H20N2O2S2 — CID 40900523
(5Z)-5-(3,4-dihydro-2H-quinolin-1-ylmethylidene)-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 40900523) has the molecular formula C18H20N2O2S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (5Z)-5-(3,4-dihydro-2H-quinolin-1-ylmethylidene)-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(3,4-dihydro-2H-quinolin-1-ylmethylidene)-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 40900523 |
| Molecular Formula | C18H20N2O2S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (5Z)-5-(3,4-dihydro-2H-quinolin-1-ylmethylidene)-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/N2CCCc3ccccc32)SC(=S)N1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C18H20N2O2S2/c21-17-16(24-18(23)20(17)11-14-7-4-10-22-14)12-19-9-3-6-13-5-1-2-8-15(13)19/h1-2,5,8,12,14H,3-4,6-7,9-11H2/b16-12-/t14-/m0/s1 |
| InChIKey | MKYSJLQCSVHUDY-QXPQOBGOSA-N |
| XLogP | 3.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|