About N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide
N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide (PubChem CID 40900561) has the molecular formula C19H37NO2
and a molecular weight of 311.51 g/mol. Its IUPAC name is N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide.
Molecular Properties
| Compound Name | N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide |
| PubChem CID | 40900561 |
| Molecular Formula | C19H37NO2 |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide |
| SMILES | CCN(CC)C(=O)C[C@]1(CCC(C)C)CCO[C@@H](C(C)C)C1 |
| InChI | InChI=1S/C19H37NO2/c1-7-20(8-2)18(21)14-19(10-9-15(3)4)11-12-22-17(13-19)16(5)6/h15-17H,7-14H2,1-6H3/t17-,19-/m1/s1 |
| InChIKey | GTTBQRNGTQUNST-IEBWSBKVSA-N |
| XLogP | 4.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide?
The IUPAC name of N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide (CID 40900561) is N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide.
What is the SMILES notation for N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide?
The canonical SMILES for N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide is CCN(CC)C(=O)C[C@]1(CCC(C)C)CCO[C@@H](C(C)C)C1.
What is the InChIKey of N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide?
The InChIKey is GTTBQRNGTQUNST-IEBWSBKVSA-N. The full InChI is InChI=1S/C19H37NO2/c1-7-20(8-2)18(21)14-19(10-9-15(3)4)11-12-22-17(13-19)16(5)6/h15-17H,7-14H2,1-6H3/t17-,19-/m1/s1.
What are the key properties of N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide?
N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide has a molecular weight of 311.51 g/mol, XLogP of 4.50, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]acetamide is sourced from PubChem (CID 40900561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).