C21H17F3NOP — CID 4090491
1-diphenylphosphoryl-1-phenyl-N-(2,2,2-trifluoroethyl)methanimine (PubChem CID 4090491) has the molecular formula C21H17F3NOP and a molecular weight of 387.34 g/mol. Its IUPAC name is 1-diphenylphosphoryl-1-phenyl-N-(2,2,2-trifluoroethyl)methanimine.
| Compound Name | 1-diphenylphosphoryl-1-phenyl-N-(2,2,2-trifluoroethyl)methanimine |
|---|---|
| PubChem CID | 4090491 |
| Molecular Formula | C21H17F3NOP |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 1-diphenylphosphoryl-1-phenyl-N-(2,2,2-trifluoroethyl)methanimine |
| SMILES | O=P(/C(=N/CC(F)(F)F)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17F3NOP/c22-21(23,24)16-25-20(17-10-4-1-5-11-17)27(26,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H,16H2/b25-20+ |
| InChIKey | FTGPOFSZYRPWGG-LKUDQCMESA-N |
| XLogP | 5.01 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|