C22H23BrN2O3 — CID 4090511
2-[[4-(4-bromophenoxy)anilino]methyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 4090511) has the molecular formula C22H23BrN2O3 and a molecular weight of 443.34 g/mol. Its IUPAC name is 2-[[4-(4-bromophenoxy)anilino]methyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-[[4-(4-bromophenoxy)anilino]methyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 4090511 |
| Molecular Formula | C22H23BrN2O3 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 2-[[4-(4-bromophenoxy)anilino]methyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC1CCC2C(=O)N(CNc3ccc(Oc4ccc(Br)cc4)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C22H23BrN2O3/c1-14-2-11-19-20(12-14)22(27)25(21(19)26)13-24-16-5-9-18(10-6-16)28-17-7-3-15(23)4-8-17/h3-10,14,19-20,24H,2,11-13H2,1H3 |
| InChIKey | LDALHFVGDABISL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|