About 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal
3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal (PubChem CID 4090699) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal.
Molecular Properties
| Compound Name | 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal |
| PubChem CID | 4090699 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal |
| SMILES | Cc1nnc(SCCC=O)o1 |
| InChI | InChI=1S/C6H8N2O2S/c1-5-7-8-6(10-5)11-4-2-3-9/h3H,2,4H2,1H3 |
| InChIKey | VIILFJQJCRPUGP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal?
The IUPAC name of 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal (CID 4090699) is 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal.
What is the SMILES notation for 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal?
The canonical SMILES for 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal is Cc1nnc(SCCC=O)o1.
What is the InChIKey of 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal?
The InChIKey is VIILFJQJCRPUGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-5-7-8-6(10-5)11-4-2-3-9/h3H,2,4H2,1H3.
What are the key properties of 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal?
3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal has a molecular weight of 172.21 g/mol, XLogP of 1.06, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanal is sourced from PubChem (CID 4090699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).