C21H28N2S2 — CID 4090830
1-cyclohexyl-3-(2-ethylphenyl)-1-(1-thiophen-2-ylethyl)thiourea (PubChem CID 4090830) has the molecular formula C21H28N2S2 and a molecular weight of 372.60 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2-ethylphenyl)-1-(1-thiophen-2-ylethyl)thiourea.
| Compound Name | 1-cyclohexyl-3-(2-ethylphenyl)-1-(1-thiophen-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 4090830 |
| Molecular Formula | C21H28N2S2 |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-cyclohexyl-3-(2-ethylphenyl)-1-(1-thiophen-2-ylethyl)thiourea |
| SMILES | CCc1ccccc1NC(=S)N(C1CCCCC1)C(C)c1cccs1 |
| InChI | InChI=1S/C21H28N2S2/c1-3-17-10-7-8-13-19(17)22-21(24)23(18-11-5-4-6-12-18)16(2)20-14-9-15-25-20/h7-10,13-16,18H,3-6,11-12H2,1-2H3,(H,22,24) |
| InChIKey | PFWRRFAHZWXPHX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|