About tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane
tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane (PubChem CID 4091450) has the molecular formula C24H21N6P
and a molecular weight of 424.45 g/mol. Its IUPAC name is tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane.
Molecular Properties
| Compound Name | tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane |
| PubChem CID | 4091450 |
| Molecular Formula | C24H21N6P |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane |
| SMILES | Cc1nc2ccccn2c1P(c1c(C)nc2ccccn12)c1c(C)nc2ccccn12 |
| InChI | InChI=1S/C24H21N6P/c1-16-22(28-13-7-4-10-19(28)25-16)31(23-17(2)26-20-11-5-8-14-29(20)23)24-18(3)27-21-12-6-9-15-30(21)24/h4-15H,1-3H3 |
| InChIKey | JOKDXCUTOFAFDH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 51.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane?
The IUPAC name of tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane (CID 4091450) is tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane.
What is the SMILES notation for tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane?
The canonical SMILES for tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane is Cc1nc2ccccn2c1P(c1c(C)nc2ccccn12)c1c(C)nc2ccccn12.
What is the InChIKey of tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane?
The InChIKey is JOKDXCUTOFAFDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N6P/c1-16-22(28-13-7-4-10-19(28)25-16)31(23-17(2)26-20-11-5-8-14-29(20)23)24-18(3)27-21-12-6-9-15-30(21)24/h4-15H,1-3H3.
What are the key properties of tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane?
tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane has a molecular weight of 424.45 g/mol, XLogP of 3.31, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-methylimidazo[1,2-a]pyridin-3-yl)phosphane is sourced from PubChem (CID 4091450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).