About 3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one
3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one (PubChem CID 4091501) has the molecular formula C21H30N3O3+
and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one |
| PubChem CID | 4091501 |
| Molecular Formula | C21H30N3O3+ |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one |
| SMILES | Cc1[nH]c2ccc(N3CCOCC3)cc2c(=O)c1C[NH+]1CC(C)OC(C)C1 |
| InChI | InChI=1S/C21H29N3O3/c1-14-11-23(12-15(2)27-14)13-19-16(3)22-20-5-4-17(10-18(20)21(19)25)24-6-8-26-9-7-24/h4-5,10,14-15H,6-9,11-13H2,1-3H3,(H,22,25)/p+1 |
| InChIKey | GYIBDEDBVIYNMN-UHFFFAOYSA-O |
| XLogP | 0.87 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one?
The IUPAC name of 3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one (CID 4091501) is 3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one.
What is the SMILES notation for 3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one?
The canonical SMILES for 3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one is Cc1[nH]c2ccc(N3CCOCC3)cc2c(=O)c1C[NH+]1CC(C)OC(C)C1.
What is the InChIKey of 3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one?
The InChIKey is GYIBDEDBVIYNMN-UHFFFAOYSA-O. The full InChI is InChI=1S/C21H29N3O3/c1-14-11-23(12-15(2)27-14)13-19-16(3)22-20-5-4-17(10-18(20)21(19)25)24-6-8-26-9-7-24/h4-5,10,14-15H,6-9,11-13H2,1-3H3,(H,22,25)/p+1.
What are the key properties of 3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one?
3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one has a molecular weight of 372.49 g/mol, XLogP of 0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-2-methyl-6-morpholin-4-yl-1H-quinolin-4-one is sourced from PubChem (CID 4091501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).