C32H28ClN5 — CID 40916471
4-[(3R)-2-(6-chloro-4-phenylquinazolin-2-yl)-5-(4-methylphenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline (PubChem CID 40916471) has the molecular formula C32H28ClN5 and a molecular weight of 518.06 g/mol. Its IUPAC name is 4-[(3R)-2-(6-chloro-4-phenylquinazolin-2-yl)-5-(4-methylphenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(3R)-2-(6-chloro-4-phenylquinazolin-2-yl)-5-(4-methylphenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 40916471 |
| Molecular Formula | C32H28ClN5 |
| Molecular Weight | 518.06 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 4-[(3R)-2-(6-chloro-4-phenylquinazolin-2-yl)-5-(4-methylphenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline |
| SMILES | Cc1ccc(C2=NN(c3nc(-c4ccccc4)c4cc(Cl)ccc4n3)[C@@H](c3ccc(N(C)C)cc3)C2)cc1 |
| InChI | InChI=1S/C32H28ClN5/c1-21-9-11-22(12-10-21)29-20-30(23-13-16-26(17-14-23)37(2)3)38(36-29)32-34-28-18-15-25(33)19-27(28)31(35-32)24-7-5-4-6-8-24/h4-19,30H,20H2,1-3H3/t30-/m1/s1 |
| InChIKey | RWSBMTJNRSBJJO-SSEXGKCCSA-N |
| XLogP | 7.68 |
| TPSA | 44.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.06 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|